C11H12O3 — CID 14941867
(3R)-3-(methoxymethyl)-3,4-dihydrochromen-2-one (PubChem CID 14941867) has the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. Its IUPAC name is (3R)-3-(methoxymethyl)-3,4-dihydrochromen-2-one.
| Compound Name | (3R)-3-(methoxymethyl)-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 14941867 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | (3R)-3-(methoxymethyl)-3,4-dihydrochromen-2-one |
| SMILES | COC[C@H]1Cc2ccccc2OC1=O |
| InChI | InChI=1S/C11H12O3/c1-13-7-9-6-8-4-2-3-5-10(8)14-11(9)12/h2-5,9H,6-7H2,1H3/t9-/m1/s1 |
| InChIKey | XKDIYLJHOLRJFU-SECBINFHSA-N |
| XLogP | 1.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|