C16H15NO2 — CID 160784007
3-[4-(methylamino)phenyl]-3,4-dihydrochromen-2-one (PubChem CID 160784007) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is 3-[4-(methylamino)phenyl]-3,4-dihydrochromen-2-one.
| Compound Name | 3-[4-(methylamino)phenyl]-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 160784007 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 3-[4-(methylamino)phenyl]-3,4-dihydrochromen-2-one |
| SMILES | CNc1ccc(C2Cc3ccccc3OC2=O)cc1 |
| InChI | InChI=1S/C16H15NO2/c1-17-13-8-6-11(7-9-13)14-10-12-4-2-3-5-15(12)19-16(14)18/h2-9,14,17H,10H2,1H3 |
| InChIKey | SAYRTAUNMWBUJY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|