C10H9NO4 — CID 101202113
3-(nitromethyl)-3,4-dihydrochromen-2-one (PubChem CID 101202113) has the molecular formula C10H9NO4 and a molecular weight of 207.19 g/mol. Its IUPAC name is 3-(nitromethyl)-3,4-dihydrochromen-2-one.
| Compound Name | 3-(nitromethyl)-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 101202113 |
| Molecular Formula | C10H9NO4 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 3-(nitromethyl)-3,4-dihydrochromen-2-one |
| SMILES | O=C1Oc2ccccc2CC1C[N+](=O)[O-] |
| InChI | InChI=1S/C10H9NO4/c12-10-8(6-11(13)14)5-7-3-1-2-4-9(7)15-10/h1-4,8H,5-6H2 |
| InChIKey | SJRBYCOULNASJG-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|