C12H13NO4 — CID 53359769
(3S,4R)-3,6-dimethyl-4-(nitromethyl)-3,4-dihydrochromen-2-one (PubChem CID 53359769) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is (3S,4R)-3,6-dimethyl-4-(nitromethyl)-3,4-dihydrochromen-2-one.
| Compound Name | (3S,4R)-3,6-dimethyl-4-(nitromethyl)-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 53359769 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | (3S,4R)-3,6-dimethyl-4-(nitromethyl)-3,4-dihydrochromen-2-one |
| SMILES | Cc1ccc2c(c1)[C@H](C[N+](=O)[O-])[C@H](C)C(=O)O2 |
| InChI | InChI=1S/C12H13NO4/c1-7-3-4-11-9(5-7)10(6-13(15)16)8(2)12(14)17-11/h3-5,8,10H,6H2,1-2H3/t8-,10+/m0/s1 |
| InChIKey | ZPIZOMQTVDCXLA-WCBMZHEXSA-N |
| XLogP | 1.91 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|