C16H13NO5 — CID 21141176
N-hydroxy-4-(2-oxo-3,4-dihydrochromene-3-carbonyl)benzeneamine oxide (PubChem CID 21141176) has the molecular formula C16H13NO5 and a molecular weight of 299.28 g/mol. Its IUPAC name is N-hydroxy-4-(2-oxo-3,4-dihydrochromene-3-carbonyl)benzeneamine oxide.
| Compound Name | N-hydroxy-4-(2-oxo-3,4-dihydrochromene-3-carbonyl)benzeneamine oxide |
|---|---|
| PubChem CID | 21141176 |
| Molecular Formula | C16H13NO5 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | N-hydroxy-4-(2-oxo-3,4-dihydrochromene-3-carbonyl)benzeneamine oxide |
| SMILES | O=C1Oc2ccccc2CC1C(=O)c1ccc([NH+]([O-])O)cc1 |
| InChI | InChI=1S/C16H13NO5/c18-15(10-5-7-12(8-6-10)17(20)21)13-9-11-3-1-2-4-14(11)22-16(13)19/h1-8,13,17,20H,9H2 |
| InChIKey | DVACHMGSBGMLEI-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 91.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|