C23H19NO3 — CID 136732104
3-[2-[(2-hydroxyphenyl)methylideneamino]-5-methylphenyl]-3,4-dihydrochromen-2-one (PubChem CID 136732104) has the molecular formula C23H19NO3 and a molecular weight of 357.41 g/mol. Its IUPAC name is 3-[2-[(2-hydroxyphenyl)methylideneamino]-5-methylphenyl]-3,4-dihydrochromen-2-one.
| Compound Name | 3-[2-[(2-hydroxyphenyl)methylideneamino]-5-methylphenyl]-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 136732104 |
| Molecular Formula | C23H19NO3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 3-[2-[(2-hydroxyphenyl)methylideneamino]-5-methylphenyl]-3,4-dihydrochromen-2-one |
| SMILES | Cc1ccc(/N=C/c2ccccc2O)c(C2Cc3ccccc3OC2=O)c1 |
| InChI | InChI=1S/C23H19NO3/c1-15-10-11-20(24-14-17-7-2-4-8-21(17)25)18(12-15)19-13-16-6-3-5-9-22(16)27-23(19)26/h2-12,14,19,25H,13H2,1H3/b24-14+ |
| InChIKey | PDMPDGDODGSSJG-ZVHZXABRSA-N |
| XLogP | 4.70 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|