C19H15Cl2N3O3 — CID 44515790
2-(3-amino-5-imino-4H-1,2-oxazol-4-yl)-1,4-bis(4-chlorophenyl)butane-1,4-dione (PubChem CID 44515790) has the molecular formula C19H15Cl2N3O3 and a molecular weight of 404.25 g/mol. Its IUPAC name is 2-(3-amino-5-imino-4H-1,2-oxazol-4-yl)-1,4-bis(4-chlorophenyl)butane-1,4-dione.
| Compound Name | 2-(3-amino-5-imino-4H-1,2-oxazol-4-yl)-1,4-bis(4-chlorophenyl)butane-1,4-dione |
|---|---|
| PubChem CID | 44515790 |
| Molecular Formula | C19H15Cl2N3O3 |
| Molecular Weight | 404.25 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | 2-(3-amino-5-imino-4H-1,2-oxazol-4-yl)-1,4-bis(4-chlorophenyl)butane-1,4-dione |
| SMILES | [H]/N=C1\ON=C(N)C1C(CC(=O)c1ccc(Cl)cc1)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H15Cl2N3O3/c20-12-5-1-10(2-6-12)15(25)9-14(16-18(22)24-27-19(16)23)17(26)11-3-7-13(21)8-4-11/h1-8,14,16,23H,9H2,(H2,22,24)/b23-19- |
| InChIKey | KMUPFVBEIFIZQB-NMWGTECJSA-N |
| XLogP | 3.96 |
| TPSA | 105.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.25 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|