C14H19ClN2O2S — CID 119998327
N-(3-amino-2-methylpropyl)-2-[2-(4-chlorophenyl)-2-oxoethyl]sulfanylacetamide (PubChem CID 119998327) has the molecular formula C14H19ClN2O2S and a molecular weight of 314.84 g/mol. Its IUPAC name is N-(3-amino-2-methylpropyl)-2-[2-(4-chlorophenyl)-2-oxoethyl]sulfanylacetamide.
| Compound Name | N-(3-amino-2-methylpropyl)-2-[2-(4-chlorophenyl)-2-oxoethyl]sulfanylacetamide |
|---|---|
| PubChem CID | 119998327 |
| Molecular Formula | C14H19ClN2O2S |
| Molecular Weight | 314.84 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | N-(3-amino-2-methylpropyl)-2-[2-(4-chlorophenyl)-2-oxoethyl]sulfanylacetamide |
| SMILES | CC(CN)CNC(=O)CSCC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H19ClN2O2S/c1-10(6-16)7-17-14(19)9-20-8-13(18)11-2-4-12(15)5-3-11/h2-5,10H,6-9,16H2,1H3,(H,17,19) |
| InChIKey | OKQANPLWHWZWFN-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.84 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |