C16H23ClN2O2S — CID 119641139
N-(2-amino-2-ethylbutyl)-2-[2-(4-chlorophenyl)-2-oxoethyl]sulfanylacetamide (PubChem CID 119641139) has the molecular formula C16H23ClN2O2S and a molecular weight of 342.89 g/mol. Its IUPAC name is N-(2-amino-2-ethylbutyl)-2-[2-(4-chlorophenyl)-2-oxoethyl]sulfanylacetamide.
| Compound Name | N-(2-amino-2-ethylbutyl)-2-[2-(4-chlorophenyl)-2-oxoethyl]sulfanylacetamide |
|---|---|
| PubChem CID | 119641139 |
| Molecular Formula | C16H23ClN2O2S |
| Molecular Weight | 342.89 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | N-(2-amino-2-ethylbutyl)-2-[2-(4-chlorophenyl)-2-oxoethyl]sulfanylacetamide |
| SMILES | CCC(N)(CC)CNC(=O)CSCC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H23ClN2O2S/c1-3-16(18,4-2)11-19-15(21)10-22-9-14(20)12-5-7-13(17)8-6-12/h5-8H,3-4,9-11,18H2,1-2H3,(H,19,21) |
| InChIKey | CTVHRRFEYIOMBF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.89 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |