C20H20ClN3O4 — CID 135747182
diethyl 2-[[(3-chloro-5,11-dihydropyrrolo[2,1-c][1,4]benzodiazepin-6-ylidene)amino]methylidene]propanedioate (PubChem CID 135747182) has the molecular formula C20H20ClN3O4 and a molecular weight of 401.85 g/mol. Its IUPAC name is diethyl 2-[[(3-chloro-5,11-dihydropyrrolo[2,1-c][1,4]benzodiazepin-6-ylidene)amino]methylidene]propanedioate.
| Compound Name | diethyl 2-[[(3-chloro-5,11-dihydropyrrolo[2,1-c][1,4]benzodiazepin-6-ylidene)amino]methylidene]propanedioate |
|---|---|
| PubChem CID | 135747182 |
| Molecular Formula | C20H20ClN3O4 |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | diethyl 2-[[(3-chloro-5,11-dihydropyrrolo[2,1-c][1,4]benzodiazepin-6-ylidene)amino]methylidene]propanedioate |
| SMILES | CCOC(=O)C(=C/N=C1\Nc2cc(Cl)ccc2Cn2cccc21)C(=O)OCC |
| InChI | InChI=1S/C20H20ClN3O4/c1-3-27-19(25)15(20(26)28-4-2)11-22-18-17-6-5-9-24(17)12-13-7-8-14(21)10-16(13)23-18/h5-11H,3-4,12H2,1-2H3,(H,22,23) |
| InChIKey | BGJYILFVTAOYPY-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|