C16H17ClN2O5 — CID 139216848
diethyl 2-[(6-chloro-3-oxo-2,4-dihydroquinoxalin-1-yl)methylidene]propanedioate (PubChem CID 139216848) has the molecular formula C16H17ClN2O5 and a molecular weight of 352.77 g/mol. Its IUPAC name is diethyl 2-[(6-chloro-3-oxo-2,4-dihydroquinoxalin-1-yl)methylidene]propanedioate.
| Compound Name | diethyl 2-[(6-chloro-3-oxo-2,4-dihydroquinoxalin-1-yl)methylidene]propanedioate |
|---|---|
| PubChem CID | 139216848 |
| Molecular Formula | C16H17ClN2O5 |
| Molecular Weight | 352.77 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | diethyl 2-[(6-chloro-3-oxo-2,4-dihydroquinoxalin-1-yl)methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CN1CC(=O)Nc2cc(Cl)ccc21)C(=O)OCC |
| InChI | InChI=1S/C16H17ClN2O5/c1-3-23-15(21)11(16(22)24-4-2)8-19-9-14(20)18-12-7-10(17)5-6-13(12)19/h5-8H,3-4,9H2,1-2H3,(H,18,20) |
| InChIKey | RIBIPSGVPDQZFB-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.77 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|