C18H22ClNO5 — CID 92687585
diethyl 2-[[(2R)-6-chloro-2-ethyl-2,3-dihydro-1,4-benzoxazin-4-yl]methylidene]propanedioate (PubChem CID 92687585) has the molecular formula C18H22ClNO5 and a molecular weight of 367.83 g/mol. Its IUPAC name is diethyl 2-[[(2R)-6-chloro-2-ethyl-2,3-dihydro-1,4-benzoxazin-4-yl]methylidene]propanedioate.
| Compound Name | diethyl 2-[[(2R)-6-chloro-2-ethyl-2,3-dihydro-1,4-benzoxazin-4-yl]methylidene]propanedioate |
|---|---|
| PubChem CID | 92687585 |
| Molecular Formula | C18H22ClNO5 |
| Molecular Weight | 367.83 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | diethyl 2-[[(2R)-6-chloro-2-ethyl-2,3-dihydro-1,4-benzoxazin-4-yl]methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CN1C[C@@H](CC)Oc2ccc(Cl)cc21)C(=O)OCC |
| InChI | InChI=1S/C18H22ClNO5/c1-4-13-10-20(15-9-12(19)7-8-16(15)25-13)11-14(17(21)23-5-2)18(22)24-6-3/h7-9,11,13H,4-6,10H2,1-3H3/t13-/m1/s1 |
| InChIKey | HBFOCUREXOXBKB-CYBMUJFWSA-N |
| XLogP | 3.33 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.83 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|