C38H44N4O8S2 — CID 76619831
2-[2-[3-[isocyano-[3-(3-methylpentyl)-1,3-benzothiazol-2-ylidene]methyl]peroxypropoxy]ethoxy]ethyl 2-cyano-2-[3-(3-prop-2-enoyloxypropyl)-1,3-benzothiazol-2-ylidene]acetate (PubChem CID 76619831) has the molecular formula C38H44N4O8S2 and a molecular weight of 748.92 g/mol. Its IUPAC name is 2-[2-[3-[isocyano-[3-(3-methylpentyl)-1,3-benzothiazol-2-ylidene]methyl]peroxypropoxy]ethoxy]ethyl 2-cyano-2-[3-(3-prop-2-enoyloxypropyl)-1,3-benzothiazol-2-ylidene]acetate.
| Compound Name | 2-[2-[3-[isocyano-[3-(3-methylpentyl)-1,3-benzothiazol-2-ylidene]methyl]peroxypropoxy]ethoxy]ethyl 2-cyano-2-[3-(3-prop-2-enoyloxypropyl)-1,3-benzothiazol-2-ylidene]acetate |
|---|---|
| PubChem CID | 76619831 |
| Molecular Formula | C38H44N4O8S2 |
| Molecular Weight | 748.92 g/mol |
| Exact Mass | 748.26 |
| IUPAC Name | 2-[2-[3-[isocyano-[3-(3-methylpentyl)-1,3-benzothiazol-2-ylidene]methyl]peroxypropoxy]ethoxy]ethyl 2-cyano-2-[3-(3-prop-2-enoyloxypropyl)-1,3-benzothiazol-2-ylidene]acetate |
| SMILES | [C-]#[N+]C(OOCCCOCCOCCOC(=O)C(C#N)=C1Sc2ccccc2N1CCCOC(=O)C=C)=C1Sc2ccccc2N1CCC(C)CC |
| InChI | InChI=1S/C38H44N4O8S2/c1-5-28(3)17-19-42-31-14-8-10-16-33(31)52-37(42)35(40-4)50-49-22-12-20-45-23-24-46-25-26-48-38(44)29(27-39)36-41(18-11-21-47-34(43)6-2)30-13-7-9-15-32(30)51-36/h6-10,13-16,28H,2,5,11-12,17-26H2,1,3H3 |
| InChIKey | QGXIGEQYKNDIRB-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 124.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.92 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|