C18H19ClN2O4S — CID 76619841
2-(oxiran-2-yloxy)ethyl 2-(3-butyl-6-chloro-1,3-benzothiazol-2-ylidene)-2-cyanoacetate (PubChem CID 76619841) has the molecular formula C18H19ClN2O4S and a molecular weight of 394.88 g/mol. Its IUPAC name is 2-(oxiran-2-yloxy)ethyl 2-(3-butyl-6-chloro-1,3-benzothiazol-2-ylidene)-2-cyanoacetate.
| Compound Name | 2-(oxiran-2-yloxy)ethyl 2-(3-butyl-6-chloro-1,3-benzothiazol-2-ylidene)-2-cyanoacetate |
|---|---|
| PubChem CID | 76619841 |
| Molecular Formula | C18H19ClN2O4S |
| Molecular Weight | 394.88 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 2-(oxiran-2-yloxy)ethyl 2-(3-butyl-6-chloro-1,3-benzothiazol-2-ylidene)-2-cyanoacetate |
| SMILES | CCCCN1C(=C(C#N)C(=O)OCCOC2CO2)Sc2cc(Cl)ccc21 |
| InChI | InChI=1S/C18H19ClN2O4S/c1-2-3-6-21-14-5-4-12(19)9-15(14)26-17(21)13(10-20)18(22)24-8-7-23-16-11-25-16/h4-5,9,16H,2-3,6-8,11H2,1H3 |
| InChIKey | IAMWSXQYBLPNFB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 75.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.88 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|