C22H18Cl2N2O3S — CID 3626060
ethyl 2-cyano-2-[5-[(2,4-dichlorophenyl)methyl]-3-(4-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]acetate (PubChem CID 3626060) has the molecular formula C22H18Cl2N2O3S and a molecular weight of 461.37 g/mol. Its IUPAC name is ethyl 2-cyano-2-[5-[(2,4-dichlorophenyl)methyl]-3-(4-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]acetate.
| Compound Name | ethyl 2-cyano-2-[5-[(2,4-dichlorophenyl)methyl]-3-(4-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]acetate |
|---|---|
| PubChem CID | 3626060 |
| Molecular Formula | C22H18Cl2N2O3S |
| Molecular Weight | 461.37 g/mol |
| Exact Mass | 460.04 |
| IUPAC Name | ethyl 2-cyano-2-[5-[(2,4-dichlorophenyl)methyl]-3-(4-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]acetate |
| SMILES | CCOC(=O)C(C#N)=C1SC(Cc2ccc(Cl)cc2Cl)C(=O)N1c1ccc(C)cc1 |
| InChI | InChI=1S/C22H18Cl2N2O3S/c1-3-29-22(28)17(12-25)21-26(16-8-4-13(2)5-9-16)20(27)19(30-21)10-14-6-7-15(23)11-18(14)24/h4-9,11,19H,3,10H2,1-2H3 |
| InChIKey | BZOWRJSFLOHFJE-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.37 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|