C21H29NO4 — CID 91122695
6-methoxyhexyl prop-2-enoate;3-methyl-5-(4-methylphenyl)-1,2-oxazole (PubChem CID 91122695) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is 6-methoxyhexyl prop-2-enoate;3-methyl-5-(4-methylphenyl)-1,2-oxazole.
| Compound Name | 6-methoxyhexyl prop-2-enoate;3-methyl-5-(4-methylphenyl)-1,2-oxazole |
|---|---|
| PubChem CID | 91122695 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 6-methoxyhexyl prop-2-enoate;3-methyl-5-(4-methylphenyl)-1,2-oxazole |
| SMILES | C=CC(=O)OCCCCCCOC.Cc1ccc(-c2cc(C)no2)cc1 |
| InChI | InChI=1S/C11H11NO.C10H18O3/c1-8-3-5-10(6-4-8)11-7-9(2)12-13-11;1-3-10(11)13-9-7-5-4-6-8-12-2/h3-7H,1-2H3;3H,1,4-9H2,2H3 |
| InChIKey | RILJQHXLDQGOTF-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|