About 4-methoxybutyl prop-2-enoate;4-methyl-2-(3-methylphenyl)furan
4-methoxybutyl prop-2-enoate;4-methyl-2-(3-methylphenyl)furan (PubChem CID 90734557) has the molecular formula C20H26O4
and a molecular weight of 330.42 g/mol. Its IUPAC name is 4-methoxybutyl prop-2-enoate;4-methyl-2-(3-methylphenyl)furan.
Molecular Properties
| Compound Name | 4-methoxybutyl prop-2-enoate;4-methyl-2-(3-methylphenyl)furan |
| PubChem CID | 90734557 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 4-methoxybutyl prop-2-enoate;4-methyl-2-(3-methylphenyl)furan |
| SMILES | C=CC(=O)OCCCCOC.Cc1cccc(-c2cc(C)co2)c1 |
| InChI | InChI=1S/C12H12O.C8H14O3/c1-9-4-3-5-11(6-9)12-7-10(2)8-13-12;1-3-8(9)11-7-5-4-6-10-2/h3-8H,1-2H3;3H,1,4-7H2,2H3 |
| InChIKey | ABMWLYXARKIFAQ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxybutyl prop-2-enoate;4-methyl-2-(3-methylphenyl)furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxybutyl prop-2-enoate;4-methyl-2-(3-methylphenyl)furan?
The IUPAC name of 4-methoxybutyl prop-2-enoate;4-methyl-2-(3-methylphenyl)furan (CID 90734557) is 4-methoxybutyl prop-2-enoate;4-methyl-2-(3-methylphenyl)furan.
What is the SMILES notation for 4-methoxybutyl prop-2-enoate;4-methyl-2-(3-methylphenyl)furan?
The canonical SMILES for 4-methoxybutyl prop-2-enoate;4-methyl-2-(3-methylphenyl)furan is C=CC(=O)OCCCCOC.Cc1cccc(-c2cc(C)co2)c1.
What is the InChIKey of 4-methoxybutyl prop-2-enoate;4-methyl-2-(3-methylphenyl)furan?
The InChIKey is ABMWLYXARKIFAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O.C8H14O3/c1-9-4-3-5-11(6-9)12-7-10(2)8-13-12;1-3-8(9)11-7-5-4-6-10-2/h3-8H,1-2H3;3H,1,4-7H2,2H3.
What are the key properties of 4-methoxybutyl prop-2-enoate;4-methyl-2-(3-methylphenyl)furan?
4-methoxybutyl prop-2-enoate;4-methyl-2-(3-methylphenyl)furan has a molecular weight of 330.42 g/mol, XLogP of 4.71, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxybutyl prop-2-enoate;4-methyl-2-(3-methylphenyl)furan is sourced from PubChem (CID 90734557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).