C20H27FN2O4 — CID 91208233
3-(3-fluoro-4-methylphenyl)-5-methyl-1,2,4-oxadiazole;6-methoxyhexyl prop-2-enoate (PubChem CID 91208233) has the molecular formula C20H27FN2O4 and a molecular weight of 378.44 g/mol. Its IUPAC name is 3-(3-fluoro-4-methylphenyl)-5-methyl-1,2,4-oxadiazole;6-methoxyhexyl prop-2-enoate.
| Compound Name | 3-(3-fluoro-4-methylphenyl)-5-methyl-1,2,4-oxadiazole;6-methoxyhexyl prop-2-enoate |
|---|---|
| PubChem CID | 91208233 |
| Molecular Formula | C20H27FN2O4 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | 3-(3-fluoro-4-methylphenyl)-5-methyl-1,2,4-oxadiazole;6-methoxyhexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCOC.Cc1nc(-c2ccc(C)c(F)c2)no1 |
| InChI | InChI=1S/C10H9FN2O.C10H18O3/c1-6-3-4-8(5-9(6)11)10-12-7(2)14-13-10;1-3-10(11)13-9-7-5-4-6-8-12-2/h3-5H,1-2H3;3H,1,4-9H2,2H3 |
| InChIKey | PUHUBQHVJHHBOM-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|