C18H23ClN2O4 — CID 91006809
3-(3-chloro-4-methylphenyl)-5-methyl-1,2,4-oxadiazole;4-methoxybutan-2-yl prop-2-enoate (PubChem CID 91006809) has the molecular formula C18H23ClN2O4 and a molecular weight of 366.85 g/mol. Its IUPAC name is 3-(3-chloro-4-methylphenyl)-5-methyl-1,2,4-oxadiazole;4-methoxybutan-2-yl prop-2-enoate.
| Compound Name | 3-(3-chloro-4-methylphenyl)-5-methyl-1,2,4-oxadiazole;4-methoxybutan-2-yl prop-2-enoate |
|---|---|
| PubChem CID | 91006809 |
| Molecular Formula | C18H23ClN2O4 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 3-(3-chloro-4-methylphenyl)-5-methyl-1,2,4-oxadiazole;4-methoxybutan-2-yl prop-2-enoate |
| SMILES | C=CC(=O)OC(C)CCOC.Cc1nc(-c2ccc(C)c(Cl)c2)no1 |
| InChI | InChI=1S/C10H9ClN2O.C8H14O3/c1-6-3-4-8(5-9(6)11)10-12-7(2)14-13-10;1-4-8(9)11-7(2)5-6-10-3/h3-5H,1-2H3;4,7H,1,5-6H2,2-3H3 |
| InChIKey | ALCRHYLWBPRGQK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|