C17H18N2O6 — CID 59775522
4-[4-(5-acetyloxy-1,2,4-oxadiazol-3-yl)phenoxy]butyl prop-2-enoate (PubChem CID 59775522) has the molecular formula C17H18N2O6 and a molecular weight of 346.34 g/mol. Its IUPAC name is 4-[4-(5-acetyloxy-1,2,4-oxadiazol-3-yl)phenoxy]butyl prop-2-enoate.
| Compound Name | 4-[4-(5-acetyloxy-1,2,4-oxadiazol-3-yl)phenoxy]butyl prop-2-enoate |
|---|---|
| PubChem CID | 59775522 |
| Molecular Formula | C17H18N2O6 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 4-[4-(5-acetyloxy-1,2,4-oxadiazol-3-yl)phenoxy]butyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCOc1ccc(-c2noc(OC(C)=O)n2)cc1 |
| InChI | InChI=1S/C17H18N2O6/c1-3-15(21)23-11-5-4-10-22-14-8-6-13(7-9-14)16-18-17(25-19-16)24-12(2)20/h3,6-9H,1,4-5,10-11H2,2H3 |
| InChIKey | UDVNSJIQYLEXGP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 100.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|