C23H24N2O6 — CID 90943875
2-methoxyethyl prop-2-enoate;[4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]phenyl] acetate (PubChem CID 90943875) has the molecular formula C23H24N2O6 and a molecular weight of 424.45 g/mol. Its IUPAC name is 2-methoxyethyl prop-2-enoate;[4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]phenyl] acetate.
| Compound Name | 2-methoxyethyl prop-2-enoate;[4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]phenyl] acetate |
|---|---|
| PubChem CID | 90943875 |
| Molecular Formula | C23H24N2O6 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 2-methoxyethyl prop-2-enoate;[4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]phenyl] acetate |
| SMILES | C=CC(=O)OCCOC.CC(=O)Oc1ccc(-c2nc(-c3ccc(C)cc3)no2)cc1 |
| InChI | InChI=1S/C17H14N2O3.C6H10O3/c1-11-3-5-13(6-4-11)16-18-17(22-19-16)14-7-9-15(10-8-14)21-12(2)20;1-3-6(7)9-5-4-8-2/h3-10H,1-2H3;3H,1,4-5H2,2H3 |
| InChIKey | BACCIQIAOXWFOI-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 100.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|