C18H16N2O3 — CID 2993467
[4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]phenyl] propanoate (PubChem CID 2993467) has the molecular formula C18H16N2O3 and a molecular weight of 308.34 g/mol. Its IUPAC name is [4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]phenyl] propanoate.
| Compound Name | [4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]phenyl] propanoate |
|---|---|
| PubChem CID | 2993467 |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | [4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]phenyl] propanoate |
| SMILES | CCC(=O)Oc1ccc(-c2nc(-c3ccc(C)cc3)no2)cc1 |
| InChI | InChI=1S/C18H16N2O3/c1-3-16(21)22-15-10-8-14(9-11-15)18-19-17(20-23-18)13-6-4-12(2)5-7-13/h4-11H,3H2,1-2H3 |
| InChIKey | IMTBHCOHVUCPCG-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|