C11H10N2O3 — CID 154709033
[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl] acetate (PubChem CID 154709033) has the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. Its IUPAC name is [4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl] acetate.
| Compound Name | [4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl] acetate |
|---|---|
| PubChem CID | 154709033 |
| Molecular Formula | C11H10N2O3 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | [4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(-c2noc(C)n2)cc1 |
| InChI | InChI=1S/C11H10N2O3/c1-7-12-11(13-16-7)9-3-5-10(6-4-9)15-8(2)14/h3-6H,1-2H3 |
| InChIKey | UDYJAUZYMFHDKI-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|