C17H12F3N3O4 — CID 134012347
[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl] 6-(2,2,2-trifluoroethoxy)pyridine-3-carboxylate (PubChem CID 134012347) has the molecular formula C17H12F3N3O4 and a molecular weight of 379.29 g/mol. Its IUPAC name is [4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl] 6-(2,2,2-trifluoroethoxy)pyridine-3-carboxylate.
| Compound Name | [4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl] 6-(2,2,2-trifluoroethoxy)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 134012347 |
| Molecular Formula | C17H12F3N3O4 |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | [4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl] 6-(2,2,2-trifluoroethoxy)pyridine-3-carboxylate |
| SMILES | Cc1nc(-c2ccc(OC(=O)c3ccc(OCC(F)(F)F)nc3)cc2)no1 |
| InChI | InChI=1S/C17H12F3N3O4/c1-10-22-15(23-27-10)11-2-5-13(6-3-11)26-16(24)12-4-7-14(21-8-12)25-9-17(18,19)20/h2-8H,9H2,1H3 |
| InChIKey | WHUUUBMLLGKEJR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 87.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|