C20H18F7NO5 — CID 59900912
[4-[2,2-difluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]phenyl] 6-butoxypyridine-3-carboxylate (PubChem CID 59900912) has the molecular formula C20H18F7NO5 and a molecular weight of 485.35 g/mol. Its IUPAC name is [4-[2,2-difluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]phenyl] 6-butoxypyridine-3-carboxylate.
| Compound Name | [4-[2,2-difluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]phenyl] 6-butoxypyridine-3-carboxylate |
|---|---|
| PubChem CID | 59900912 |
| Molecular Formula | C20H18F7NO5 |
| Molecular Weight | 485.35 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | [4-[2,2-difluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]phenyl] 6-butoxypyridine-3-carboxylate |
| SMILES | CCCCOc1ccc(C(=O)Oc2ccc(OCC(F)(F)OC(F)(F)C(F)(F)F)cc2)cn1 |
| InChI | InChI=1S/C20H18F7NO5/c1-2-3-10-30-16-9-4-13(11-28-16)17(29)32-15-7-5-14(6-8-15)31-12-18(21,22)33-20(26,27)19(23,24)25/h4-9,11H,2-3,10,12H2,1H3 |
| InChIKey | XAOUGUNONKGJIZ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.35 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|