C30H45NO4 — CID 22845778
(4-decoxyphenyl) 6-[(2S)-octan-2-yl]oxypyridine-3-carboxylate (PubChem CID 22845778) has the molecular formula C30H45NO4 and a molecular weight of 483.69 g/mol. Its IUPAC name is (4-decoxyphenyl) 6-[(2S)-octan-2-yl]oxypyridine-3-carboxylate.
| Compound Name | (4-decoxyphenyl) 6-[(2S)-octan-2-yl]oxypyridine-3-carboxylate |
|---|---|
| PubChem CID | 22845778 |
| Molecular Formula | C30H45NO4 |
| Molecular Weight | 483.69 g/mol |
| Exact Mass | 483.33 |
| IUPAC Name | (4-decoxyphenyl) 6-[(2S)-octan-2-yl]oxypyridine-3-carboxylate |
| SMILES | CCCCCCCCCCOc1ccc(OC(=O)c2ccc(O[C@@H](C)CCCCCC)nc2)cc1 |
| InChI | InChI=1S/C30H45NO4/c1-4-6-8-10-11-12-13-15-23-33-27-18-20-28(21-19-27)35-30(32)26-17-22-29(31-24-26)34-25(3)16-14-9-7-5-2/h17-22,24-25H,4-16,23H2,1-3H3/t25-/m0/s1 |
| InChIKey | XKAJPNFQTQFXAO-VWLOTQADSA-N |
| XLogP | 8.56 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.69 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|