C8H8ClF3N2O2 — CID 165153609
6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide;hydrochloride (PubChem CID 165153609) has the molecular formula C8H8ClF3N2O2 and a molecular weight of 256.61 g/mol. Its IUPAC name is 6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide;hydrochloride.
| Compound Name | 6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 165153609 |
| Molecular Formula | C8H8ClF3N2O2 |
| Molecular Weight | 256.61 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | 6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide;hydrochloride |
| SMILES | Cl.NC(=O)c1ccc(OCC(F)(F)F)nc1 |
| InChI | InChI=1S/C8H7F3N2O2.ClH/c9-8(10,11)4-15-6-2-1-5(3-13-6)7(12)14;/h1-3H,4H2,(H2,12,14);1H |
| InChIKey | DTFZHOSOSUVFPX-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.61 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |