C13H10F3N3O2 — CID 51322720
N-pyridin-2-yl-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide (PubChem CID 51322720) has the molecular formula C13H10F3N3O2 and a molecular weight of 297.24 g/mol. Its IUPAC name is N-pyridin-2-yl-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide.
| Compound Name | N-pyridin-2-yl-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 51322720 |
| Molecular Formula | C13H10F3N3O2 |
| Molecular Weight | 297.24 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | N-pyridin-2-yl-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccccn1)c1ccc(OCC(F)(F)F)nc1 |
| InChI | InChI=1S/C13H10F3N3O2/c14-13(15,16)8-21-11-5-4-9(7-18-11)12(20)19-10-3-1-2-6-17-10/h1-7H,8H2,(H,17,19,20) |
| InChIKey | CECQIOWFBIJUIS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.24 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |