C17H13F3N5O2+ — CID 166006312
N-pyridazin-1-ium-1-yl-6-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]pyridine-3-carboxamide (PubChem CID 166006312) has the molecular formula C17H13F3N5O2+ and a molecular weight of 376.32 g/mol. Its IUPAC name is N-pyridazin-1-ium-1-yl-6-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]pyridine-3-carboxamide.
| Compound Name | N-pyridazin-1-ium-1-yl-6-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 166006312 |
| Molecular Formula | C17H13F3N5O2+ |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | N-pyridazin-1-ium-1-yl-6-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]pyridine-3-carboxamide |
| SMILES | O=C(N[n+]1ccccn1)c1ccc(-c2ccc(OCC(F)(F)F)nc2)nc1 |
| InChI | InChI=1S/C17H12F3N5O2/c18-17(19,20)11-27-15-6-4-12(9-22-15)14-5-3-13(10-21-14)16(26)24-25-8-2-1-7-23-25/h1-10H,11H2/p+1 |
| InChIKey | DDFKYVXTCMHKKJ-UHFFFAOYSA-O |
| XLogP | 2.15 |
| TPSA | 80.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|