C15H12F3N3O2 — CID 146674404
N-(benzenecarboximidoyl)-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide (PubChem CID 146674404) has the molecular formula C15H12F3N3O2 and a molecular weight of 323.27 g/mol. Its IUPAC name is N-(benzenecarboximidoyl)-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide.
| Compound Name | N-(benzenecarboximidoyl)-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 146674404 |
| Molecular Formula | C15H12F3N3O2 |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | N-(benzenecarboximidoyl)-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide |
| SMILES | [H]/N=C(/NC(=O)c1ccc(OCC(F)(F)F)nc1)c1ccccc1 |
| InChI | InChI=1S/C15H12F3N3O2/c16-15(17,18)9-23-12-7-6-11(8-20-12)14(22)21-13(19)10-4-2-1-3-5-10/h1-8H,9H2,(H2,19,21,22) |
| InChIKey | ZDMPSAPHXKVSDW-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 75.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|