C16H11F6N3O2 — CID 171130037
6-(2,2,2-trifluoroethoxy)-N-[4-(trifluoromethyl)benzenecarboximidoyl]pyridine-3-carboxamide (PubChem CID 171130037) has the molecular formula C16H11F6N3O2 and a molecular weight of 391.27 g/mol. Its IUPAC name is 6-(2,2,2-trifluoroethoxy)-N-[4-(trifluoromethyl)benzenecarboximidoyl]pyridine-3-carboxamide.
| Compound Name | 6-(2,2,2-trifluoroethoxy)-N-[4-(trifluoromethyl)benzenecarboximidoyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 171130037 |
| Molecular Formula | C16H11F6N3O2 |
| Molecular Weight | 391.27 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 6-(2,2,2-trifluoroethoxy)-N-[4-(trifluoromethyl)benzenecarboximidoyl]pyridine-3-carboxamide |
| SMILES | [H]/N=C(\NC(=O)c1ccc(OCC(F)(F)F)nc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H11F6N3O2/c17-15(18,19)8-27-12-6-3-10(7-24-12)14(26)25-13(23)9-1-4-11(5-2-9)16(20,21)22/h1-7H,8H2,(H2,23,25,26) |
| InChIKey | CCQSWAFMXHURPF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 75.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.27 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|