C14H10ClF3N4O2 — CID 138375796
2-chloro-N-(pyridine-4-carboximidoyl)-6-(2,2,2-trifluoroethoxy)pyridine-4-carboxamide (PubChem CID 138375796) has the molecular formula C14H10ClF3N4O2 and a molecular weight of 358.71 g/mol. Its IUPAC name is 2-chloro-N-(pyridine-4-carboximidoyl)-6-(2,2,2-trifluoroethoxy)pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-(pyridine-4-carboximidoyl)-6-(2,2,2-trifluoroethoxy)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 138375796 |
| Molecular Formula | C14H10ClF3N4O2 |
| Molecular Weight | 358.71 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 2-chloro-N-(pyridine-4-carboximidoyl)-6-(2,2,2-trifluoroethoxy)pyridine-4-carboxamide |
| SMILES | [H]/N=C(/NC(=O)c1cc(Cl)nc(OCC(F)(F)F)c1)c1ccncc1 |
| InChI | InChI=1S/C14H10ClF3N4O2/c15-10-5-9(6-11(21-10)24-7-14(16,17)18)13(23)22-12(19)8-1-3-20-4-2-8/h1-6H,7H2,(H2,19,22,23) |
| InChIKey | XBNLFIKUIYWYPH-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 87.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.71 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|