C8H7F3N2OS — CID 24697236
2-(2,2,2-trifluoroethoxy)pyridine-4-carbothioamide (PubChem CID 24697236) has the molecular formula C8H7F3N2OS and a molecular weight of 236.22 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethoxy)pyridine-4-carbothioamide.
| Compound Name | 2-(2,2,2-trifluoroethoxy)pyridine-4-carbothioamide |
|---|---|
| PubChem CID | 24697236 |
| Molecular Formula | C8H7F3N2OS |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.02 |
| IUPAC Name | 2-(2,2,2-trifluoroethoxy)pyridine-4-carbothioamide |
| SMILES | NC(=S)c1ccnc(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C8H7F3N2OS/c9-8(10,11)4-14-6-3-5(7(12)15)1-2-13-6/h1-3H,4H2,(H2,12,15) |
| InChIKey | IQQGKOCHRMARGV-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|