C10H12F3N3O3 — CID 168892458
[2-hydroxy-1-[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]ethyl]urea (PubChem CID 168892458) has the molecular formula C10H12F3N3O3 and a molecular weight of 279.22 g/mol. Its IUPAC name is [2-hydroxy-1-[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]ethyl]urea.
| Compound Name | [2-hydroxy-1-[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]ethyl]urea |
|---|---|
| PubChem CID | 168892458 |
| Molecular Formula | C10H12F3N3O3 |
| Molecular Weight | 279.22 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | [2-hydroxy-1-[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]ethyl]urea |
| SMILES | NC(=O)NC(CO)c1ccnc(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C10H12F3N3O3/c11-10(12,13)5-19-8-3-6(1-2-15-8)7(4-17)16-9(14)18/h1-3,7,17H,4-5H2,(H3,14,16,18) |
| InChIKey | IJKPXRZSYPRGNI-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.22 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |