C21H17F3N4O3 — CID 3575476
1,1-diphenyl-3-[[6-(2,2,2-trifluoroethoxy)pyridine-3-carbonyl]amino]urea (PubChem CID 3575476) has the molecular formula C21H17F3N4O3 and a molecular weight of 430.39 g/mol. Its IUPAC name is 1,1-diphenyl-3-[[6-(2,2,2-trifluoroethoxy)pyridine-3-carbonyl]amino]urea.
| Compound Name | 1,1-diphenyl-3-[[6-(2,2,2-trifluoroethoxy)pyridine-3-carbonyl]amino]urea |
|---|---|
| PubChem CID | 3575476 |
| Molecular Formula | C21H17F3N4O3 |
| Molecular Weight | 430.39 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 1,1-diphenyl-3-[[6-(2,2,2-trifluoroethoxy)pyridine-3-carbonyl]amino]urea |
| SMILES | O=C(NNC(=O)N(c1ccccc1)c1ccccc1)c1ccc(OCC(F)(F)F)nc1 |
| InChI | InChI=1S/C21H17F3N4O3/c22-21(23,24)14-31-18-12-11-15(13-25-18)19(29)26-27-20(30)28(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-13H,14H2,(H,26,29)(H,27,30) |
| InChIKey | SWOJBIRVXFYJMO-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.39 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|