C16H14N2O2 — CID 59204295
[4-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]methanol (PubChem CID 59204295) has the molecular formula C16H14N2O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is [4-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]methanol.
| Compound Name | [4-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]methanol |
|---|---|
| PubChem CID | 59204295 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | [4-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]methanol |
| SMILES | Cc1ccc(-c2nc(-c3ccc(CO)cc3)no2)cc1 |
| InChI | InChI=1S/C16H14N2O2/c1-11-2-6-14(7-3-11)16-17-15(18-20-16)13-8-4-12(10-19)5-9-13/h2-9,19H,10H2,1H3 |
| InChIKey | SBCSLPZIIQELIB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |