C40H34N8O8 — CID 59491853
4-[3-[3-[5-[3-[3-[3-[5-(4-prop-2-enoyloxybutyl)-1,2,4-oxadiazol-3-yl]phenyl]-1,2,4-oxadiazol-5-yl]phenyl]-1,2,4-oxadiazol-3-yl]phenyl]-1,2,4-oxadiazol-5-yl]butyl prop-2-enoate (PubChem CID 59491853) has the molecular formula C40H34N8O8 and a molecular weight of 754.76 g/mol. Its IUPAC name is 4-[3-[3-[5-[3-[3-[3-[5-(4-prop-2-enoyloxybutyl)-1,2,4-oxadiazol-3-yl]phenyl]-1,2,4-oxadiazol-5-yl]phenyl]-1,2,4-oxadiazol-3-yl]phenyl]-1,2,4-oxadiazol-5-yl]butyl prop-2-enoate.
| Compound Name | 4-[3-[3-[5-[3-[3-[3-[5-(4-prop-2-enoyloxybutyl)-1,2,4-oxadiazol-3-yl]phenyl]-1,2,4-oxadiazol-5-yl]phenyl]-1,2,4-oxadiazol-3-yl]phenyl]-1,2,4-oxadiazol-5-yl]butyl prop-2-enoate |
|---|---|
| PubChem CID | 59491853 |
| Molecular Formula | C40H34N8O8 |
| Molecular Weight | 754.76 g/mol |
| Exact Mass | 754.25 |
| IUPAC Name | 4-[3-[3-[5-[3-[3-[3-[5-(4-prop-2-enoyloxybutyl)-1,2,4-oxadiazol-3-yl]phenyl]-1,2,4-oxadiazol-5-yl]phenyl]-1,2,4-oxadiazol-3-yl]phenyl]-1,2,4-oxadiazol-5-yl]butyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCc1nc(-c2cccc(-c3noc(-c4cccc(-c5nc(-c6cccc(-c7noc(CCCCOC(=O)C=C)n7)c6)no5)c4)n3)c2)no1 |
| InChI | InChI=1S/C40H34N8O8/c1-3-33(49)51-20-7-5-18-31-41-35(45-53-31)25-12-9-14-27(22-25)37-43-39(55-47-37)29-16-11-17-30(24-29)40-44-38(48-56-40)28-15-10-13-26(23-28)36-42-32(54-46-36)19-6-8-21-52-34(50)4-2/h3-4,9-17,22-24H,1-2,5-8,18-21H2 |
| InChIKey | HJSICVOZNIYHCP-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 208.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.76 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|