C32H28N8O4 — CID 158479499
3-[3-(5-butyl-1,2,4-oxadiazol-3-yl)phenyl]-5-[3-[3-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-1,2,4-oxadiazol-5-yl]phenyl]-1,2,4-oxadiazole;methane (PubChem CID 158479499) has the molecular formula C32H28N8O4 and a molecular weight of 588.63 g/mol. Its IUPAC name is 3-[3-(5-butyl-1,2,4-oxadiazol-3-yl)phenyl]-5-[3-[3-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-1,2,4-oxadiazol-5-yl]phenyl]-1,2,4-oxadiazole;methane.
| Compound Name | 3-[3-(5-butyl-1,2,4-oxadiazol-3-yl)phenyl]-5-[3-[3-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-1,2,4-oxadiazol-5-yl]phenyl]-1,2,4-oxadiazole;methane |
|---|---|
| PubChem CID | 158479499 |
| Molecular Formula | C32H28N8O4 |
| Molecular Weight | 588.63 g/mol |
| Exact Mass | 588.22 |
| IUPAC Name | 3-[3-(5-butyl-1,2,4-oxadiazol-3-yl)phenyl]-5-[3-[3-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-1,2,4-oxadiazol-5-yl]phenyl]-1,2,4-oxadiazole;methane |
| SMILES | C.CCCCc1nc(-c2cccc(-c3noc(-c4cccc(-c5nc(-c6cccc(-c7noc(C)n7)c6)no5)c4)n3)c2)no1 |
| InChI | InChI=1S/C31H24N8O4.CH4/c1-3-4-14-25-33-27(37-41-25)20-9-6-11-22(16-20)29-35-31(43-39-29)24-13-7-12-23(17-24)30-34-28(38-42-30)21-10-5-8-19(15-21)26-32-18(2)40-36-26;/h5-13,15-17H,3-4,14H2,1-2H3;1H4 |
| InChIKey | HHIRJJGMKAKDRK-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 155.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.63 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |