C17H13F4N3O2 — CID 133371723
5-butyl-3-[3-[(2,3,5,6-tetrafluoro-4-pyridinyl)oxy]phenyl]-1,2,4-oxadiazole (PubChem CID 133371723) has the molecular formula C17H13F4N3O2 and a molecular weight of 367.30 g/mol. Its IUPAC name is 5-butyl-3-[3-[(2,3,5,6-tetrafluoro-4-pyridinyl)oxy]phenyl]-1,2,4-oxadiazole.
| Compound Name | 5-butyl-3-[3-[(2,3,5,6-tetrafluoro-4-pyridinyl)oxy]phenyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 133371723 |
| Molecular Formula | C17H13F4N3O2 |
| Molecular Weight | 367.30 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 5-butyl-3-[3-[(2,3,5,6-tetrafluoro-4-pyridinyl)oxy]phenyl]-1,2,4-oxadiazole |
| SMILES | CCCCc1nc(-c2cccc(Oc3c(F)c(F)nc(F)c3F)c2)no1 |
| InChI | InChI=1S/C17H13F4N3O2/c1-2-3-7-11-22-17(24-26-11)9-5-4-6-10(8-9)25-14-12(18)15(20)23-16(21)13(14)19/h4-6,8H,2-3,7H2,1H3 |
| InChIKey | SVZKFIBTLYDSST-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 61.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.30 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|