C45H36N12O6 — CID 59491909
3-[3,5-bis[5-[3-(5-butyl-1,2,4-oxadiazol-3-yl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]-5-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-1,2,4-oxadiazole (PubChem CID 59491909) has the molecular formula C45H36N12O6 and a molecular weight of 840.86 g/mol. Its IUPAC name is 3-[3,5-bis[5-[3-(5-butyl-1,2,4-oxadiazol-3-yl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]-5-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-1,2,4-oxadiazole.
| Compound Name | 3-[3,5-bis[5-[3-(5-butyl-1,2,4-oxadiazol-3-yl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]-5-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 59491909 |
| Molecular Formula | C45H36N12O6 |
| Molecular Weight | 840.86 g/mol |
| Exact Mass | 840.29 |
| IUPAC Name | 3-[3,5-bis[5-[3-(5-butyl-1,2,4-oxadiazol-3-yl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]-5-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-1,2,4-oxadiazole |
| SMILES | CCCCc1nc(-c2cccc(-c3nc(-c4cc(-c5noc(-c6cccc(-c7noc(C)n7)c6)n5)cc(-c5noc(-c6cccc(-c7noc(CCCC)n7)c6)n5)c4)no3)c2)no1 |
| InChI | InChI=1S/C45H36N12O6/c1-4-6-17-35-47-38(53-59-35)27-12-9-15-30(20-27)44-50-41(56-62-44)33-22-32(40-49-43(61-55-40)29-14-8-11-26(19-29)37-46-25(3)58-52-37)23-34(24-33)42-51-45(63-57-42)31-16-10-13-28(21-31)39-48-36(60-54-39)18-7-5-2/h8-16,19-24H,4-7,17-18H2,1-3H3 |
| InChIKey | YLOYKPNOVRENMT-UHFFFAOYSA-N |
| XLogP | 9.98 |
| TPSA | 233.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.86 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |