C19H25NO4 — CID 91101641
4-methoxybutyl prop-2-enoate;2-methyl-5-(3-methylphenyl)-1,3-oxazole (PubChem CID 91101641) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is 4-methoxybutyl prop-2-enoate;2-methyl-5-(3-methylphenyl)-1,3-oxazole.
| Compound Name | 4-methoxybutyl prop-2-enoate;2-methyl-5-(3-methylphenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 91101641 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 4-methoxybutyl prop-2-enoate;2-methyl-5-(3-methylphenyl)-1,3-oxazole |
| SMILES | C=CC(=O)OCCCCOC.Cc1cccc(-c2cnc(C)o2)c1 |
| InChI | InChI=1S/C11H11NO.C8H14O3/c1-8-4-3-5-10(6-8)11-7-12-9(2)13-11;1-3-8(9)11-7-5-4-6-10-2/h3-7H,1-2H3;3H,1,4-7H2,2H3 |
| InChIKey | MPJVEQZEOJBRTR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|