C25H36N2O5 — CID 91179580
2-methoxyethyl prop-2-enoate;1-methoxyhexane;2-methyl-5-[2-(4-methylphenyl)ethynyl]-1,3,4-oxadiazole (PubChem CID 91179580) has the molecular formula C25H36N2O5 and a molecular weight of 444.57 g/mol. Its IUPAC name is 2-methoxyethyl prop-2-enoate;1-methoxyhexane;2-methyl-5-[2-(4-methylphenyl)ethynyl]-1,3,4-oxadiazole.
| Compound Name | 2-methoxyethyl prop-2-enoate;1-methoxyhexane;2-methyl-5-[2-(4-methylphenyl)ethynyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 91179580 |
| Molecular Formula | C25H36N2O5 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | 2-methoxyethyl prop-2-enoate;1-methoxyhexane;2-methyl-5-[2-(4-methylphenyl)ethynyl]-1,3,4-oxadiazole |
| SMILES | C=CC(=O)OCCOC.CCCCCCOC.Cc1ccc(C#Cc2nnc(C)o2)cc1 |
| InChI | InChI=1S/C12H10N2O.C7H16O.C6H10O3/c1-9-3-5-11(6-4-9)7-8-12-14-13-10(2)15-12;1-3-4-5-6-7-8-2;1-3-6(7)9-5-4-8-2/h3-6H,1-2H3;3-7H2,1-2H3;3H,1,4-5H2,2H3 |
| InChIKey | ZHFQQRRZXLUITC-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 83.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|