About methane;bis(5-(4-methylphenyl)pent-4-ynyl prop-2-enoate)
methane;bis(5-(4-methylphenyl)pent-4-ynyl prop-2-enoate) (PubChem CID 160958044) has the molecular formula C31H36O4
and a molecular weight of 472.63 g/mol. Its IUPAC name is methane;bis(5-(4-methylphenyl)pent-4-ynyl prop-2-enoate).
Molecular Properties
| Compound Name | methane;bis(5-(4-methylphenyl)pent-4-ynyl prop-2-enoate) |
| PubChem CID | 160958044 |
| Molecular Formula | C31H36O4 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | methane;bis(5-(4-methylphenyl)pent-4-ynyl prop-2-enoate) |
| SMILES | C.C=CC(=O)OCCCC#Cc1ccc(C)cc1.C=CC(=O)OCCCC#Cc1ccc(C)cc1 |
| InChI | InChI=1S/2C15H16O2.CH4/c2*1-3-15(16)17-12-6-4-5-7-14-10-8-13(2)9-11-14;/h2*3,8-11H,1,4,6,12H2,2H3;1H4 |
| InChIKey | SWQPMZKAQQBFEH-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze methane;bis(5-(4-methylphenyl)pent-4-ynyl prop-2-enoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;bis(5-(4-methylphenyl)pent-4-ynyl prop-2-enoate)?
The IUPAC name of methane;bis(5-(4-methylphenyl)pent-4-ynyl prop-2-enoate) (CID 160958044) is methane;bis(5-(4-methylphenyl)pent-4-ynyl prop-2-enoate).
What is the SMILES notation for methane;bis(5-(4-methylphenyl)pent-4-ynyl prop-2-enoate)?
The canonical SMILES for methane;bis(5-(4-methylphenyl)pent-4-ynyl prop-2-enoate) is C.C=CC(=O)OCCCC#Cc1ccc(C)cc1.C=CC(=O)OCCCC#Cc1ccc(C)cc1.
What is the InChIKey of methane;bis(5-(4-methylphenyl)pent-4-ynyl prop-2-enoate)?
The InChIKey is SWQPMZKAQQBFEH-UHFFFAOYSA-N. The full InChI is InChI=1S/2C15H16O2.CH4/c2*1-3-15(16)17-12-6-4-5-7-14-10-8-13(2)9-11-14;/h2*3,8-11H,1,4,6,12H2,2H3;1H4.
What are the key properties of methane;bis(5-(4-methylphenyl)pent-4-ynyl prop-2-enoate)?
methane;bis(5-(4-methylphenyl)pent-4-ynyl prop-2-enoate) has a molecular weight of 472.63 g/mol, XLogP of 6.35, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methane;bis(5-(4-methylphenyl)pent-4-ynyl prop-2-enoate) is sourced from PubChem (CID 160958044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).