C16H16STe — CID 20731398
2,8-dimethyl-10,12-dihydrobenzo[b][1,5]benzothiatellurocine (PubChem CID 20731398) has the molecular formula C16H16STe and a molecular weight of 367.97 g/mol. Its IUPAC name is 2,8-dimethyl-10,12-dihydrobenzo[b][1,5]benzothiatellurocine.
| Compound Name | 2,8-dimethyl-10,12-dihydrobenzo[b][1,5]benzothiatellurocine |
|---|---|
| PubChem CID | 20731398 |
| Molecular Formula | C16H16STe |
| Molecular Weight | 367.97 g/mol |
| Exact Mass | 370.00 |
| IUPAC Name | 2,8-dimethyl-10,12-dihydrobenzo[b][1,5]benzothiatellurocine |
| SMILES | Cc1ccc2c(c1)C[Te]Cc1cc(C)ccc1S2 |
| InChI | InChI=1S/C16H16STe/c1-11-3-5-15-13(7-11)9-18-10-14-8-12(2)4-6-16(14)17-15/h3-8H,9-10H2,1-2H3 |
| InChIKey | KYKIKJGTOKPTMQ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.97 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|