About ethane;1-methylthianthrene;2-methylthianthrene
ethane;1-methylthianthrene;2-methylthianthrene (PubChem CID 160659064) has the molecular formula C34H44S4
and a molecular weight of 580.99 g/mol. Its IUPAC name is ethane;1-methylthianthrene;2-methylthianthrene.
Molecular Properties
| Compound Name | ethane;1-methylthianthrene;2-methylthianthrene |
| PubChem CID | 160659064 |
| Molecular Formula | C34H44S4 |
| Molecular Weight | 580.99 g/mol |
| Exact Mass | 580.23 |
| IUPAC Name | ethane;1-methylthianthrene;2-methylthianthrene |
| SMILES | CC.CC.CC.CC.Cc1ccc2c(c1)Sc1ccccc1S2.Cc1cccc2c1Sc1ccccc1S2 |
| InChI | InChI=1S/2C13H10S2.4C2H6/c1-9-5-4-8-12-13(9)15-11-7-3-2-6-10(11)14-12;1-9-6-7-12-13(8-9)15-11-5-3-2-4-10(11)14-12;4*1-2/h2*2-8H,1H3;4*1-2H3 |
| InChIKey | RLKVYNAJRZKPFP-UHFFFAOYSA-N |
| XLogP | 13.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 580.99 |
| LogP ≤ 5 | 13.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;1-methylthianthrene;2-methylthianthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methylthianthrene;2-methylthianthrene?
The IUPAC name of ethane;1-methylthianthrene;2-methylthianthrene (CID 160659064) is ethane;1-methylthianthrene;2-methylthianthrene.
What is the SMILES notation for ethane;1-methylthianthrene;2-methylthianthrene?
The canonical SMILES for ethane;1-methylthianthrene;2-methylthianthrene is CC.CC.CC.CC.Cc1ccc2c(c1)Sc1ccccc1S2.Cc1cccc2c1Sc1ccccc1S2.
What is the InChIKey of ethane;1-methylthianthrene;2-methylthianthrene?
The InChIKey is RLKVYNAJRZKPFP-UHFFFAOYSA-N. The full InChI is InChI=1S/2C13H10S2.4C2H6/c1-9-5-4-8-12-13(9)15-11-7-3-2-6-10(11)14-12;1-9-6-7-12-13(8-9)15-11-5-3-2-4-10(11)14-12;4*1-2/h2*2-8H,1H3;4*1-2H3.
What are the key properties of ethane;1-methylthianthrene;2-methylthianthrene?
ethane;1-methylthianthrene;2-methylthianthrene has a molecular weight of 580.99 g/mol, XLogP of 13.33, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methylthianthrene;2-methylthianthrene is sourced from PubChem (CID 160659064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).