C13H10S — CID 89457439
2-(4-methylphenyl)-7-thiabicyclo[4.1.0]hepta-1,3,5-triene (PubChem CID 89457439) has the molecular formula C13H10S and a molecular weight of 198.29 g/mol. Its IUPAC name is 2-(4-methylphenyl)-7-thiabicyclo[4.1.0]hepta-1,3,5-triene.
| Compound Name | 2-(4-methylphenyl)-7-thiabicyclo[4.1.0]hepta-1,3,5-triene |
|---|---|
| PubChem CID | 89457439 |
| Molecular Formula | C13H10S |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | 2-(4-methylphenyl)-7-thiabicyclo[4.1.0]hepta-1,3,5-triene |
| SMILES | Cc1ccc(-c2cccc3c2S3)cc1 |
| InChI | InChI=1S/C13H10S/c1-9-5-7-10(8-6-9)11-3-2-4-12-13(11)14-12/h2-8H,1H3 |
| InChIKey | HSUWKDRSVAYEMJ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|