C8H8N2S2 — CID 142252397
7-methyl-1,4,2-benzodithiazin-3-amine (PubChem CID 142252397) has the molecular formula C8H8N2S2 and a molecular weight of 196.30 g/mol. Its IUPAC name is 7-methyl-1,4,2-benzodithiazin-3-amine.
| Compound Name | 7-methyl-1,4,2-benzodithiazin-3-amine |
|---|---|
| PubChem CID | 142252397 |
| Molecular Formula | C8H8N2S2 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.01 |
| IUPAC Name | 7-methyl-1,4,2-benzodithiazin-3-amine |
| SMILES | Cc1ccc2c(c1)SN=C(N)S2 |
| InChI | InChI=1S/C8H8N2S2/c1-5-2-3-6-7(4-5)12-10-8(9)11-6/h2-4H,1H3,(H2,9,10) |
| InChIKey | MVRZRQCHGADUPA-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|