C8H7NS2 — CID 13230871
3-methyl-1,4,2-benzodithiazine (PubChem CID 13230871) has the molecular formula C8H7NS2 and a molecular weight of 181.28 g/mol. Its IUPAC name is 3-methyl-1,4,2-benzodithiazine.
| Compound Name | 3-methyl-1,4,2-benzodithiazine |
|---|---|
| PubChem CID | 13230871 |
| Molecular Formula | C8H7NS2 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.00 |
| IUPAC Name | 3-methyl-1,4,2-benzodithiazine |
| SMILES | CC1=NSc2ccccc2S1 |
| InChI | InChI=1S/C8H7NS2/c1-6-9-11-8-5-3-2-4-7(8)10-6/h2-5H,1H3 |
| InChIKey | ZZENUVSNJDBDGY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|