C14H10ClNS — CID 70320004
6-chloro-3-methylbenzo[b][1,4]benzothiazepine (PubChem CID 70320004) has the molecular formula C14H10ClNS and a molecular weight of 259.76 g/mol. Its IUPAC name is 6-chloro-3-methylbenzo[b][1,4]benzothiazepine.
| Compound Name | 6-chloro-3-methylbenzo[b][1,4]benzothiazepine |
|---|---|
| PubChem CID | 70320004 |
| Molecular Formula | C14H10ClNS |
| Molecular Weight | 259.76 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | 6-chloro-3-methylbenzo[b][1,4]benzothiazepine |
| SMILES | Cc1ccc2c(c1)N=C(Cl)c1ccccc1S2 |
| InChI | InChI=1S/C14H10ClNS/c1-9-6-7-13-11(8-9)16-14(15)10-4-2-3-5-12(10)17-13/h2-8H,1H3 |
| InChIKey | LSSTXDXIEVOLRV-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.76 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |