About 6-(4-fluorophenyl)-3-methylbenzo[b][1,4]benzothiazepine
6-(4-fluorophenyl)-3-methylbenzo[b][1,4]benzothiazepine (PubChem CID 143446684) has the molecular formula C20H14FNS
and a molecular weight of 319.40 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-3-methylbenzo[b][1,4]benzothiazepine.
Molecular Properties
| Compound Name | 6-(4-fluorophenyl)-3-methylbenzo[b][1,4]benzothiazepine |
| PubChem CID | 143446684 |
| Molecular Formula | C20H14FNS |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 6-(4-fluorophenyl)-3-methylbenzo[b][1,4]benzothiazepine |
| SMILES | Cc1ccc2c(c1)N=C(c1ccc(F)cc1)c1ccccc1S2 |
| InChI | InChI=1S/C20H14FNS/c1-13-6-11-19-17(12-13)22-20(14-7-9-15(21)10-8-14)16-4-2-3-5-18(16)23-19/h2-12H,1H3 |
| InChIKey | ZNCPRIBHUPHAKR-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(4-fluorophenyl)-3-methylbenzo[b][1,4]benzothiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-fluorophenyl)-3-methylbenzo[b][1,4]benzothiazepine?
The IUPAC name of 6-(4-fluorophenyl)-3-methylbenzo[b][1,4]benzothiazepine (CID 143446684) is 6-(4-fluorophenyl)-3-methylbenzo[b][1,4]benzothiazepine.
What is the SMILES notation for 6-(4-fluorophenyl)-3-methylbenzo[b][1,4]benzothiazepine?
The canonical SMILES for 6-(4-fluorophenyl)-3-methylbenzo[b][1,4]benzothiazepine is Cc1ccc2c(c1)N=C(c1ccc(F)cc1)c1ccccc1S2.
What is the InChIKey of 6-(4-fluorophenyl)-3-methylbenzo[b][1,4]benzothiazepine?
The InChIKey is ZNCPRIBHUPHAKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14FNS/c1-13-6-11-19-17(12-13)22-20(14-7-9-15(21)10-8-14)16-4-2-3-5-18(16)23-19/h2-12H,1H3.
What are the key properties of 6-(4-fluorophenyl)-3-methylbenzo[b][1,4]benzothiazepine?
6-(4-fluorophenyl)-3-methylbenzo[b][1,4]benzothiazepine has a molecular weight of 319.40 g/mol, XLogP of 5.77, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-fluorophenyl)-3-methylbenzo[b][1,4]benzothiazepine is sourced from PubChem (CID 143446684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).